C7H13N3O — CID 78954145
3-(2-cyanopropyl)-1,1-dimethylurea (PubChem CID 78954145) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-(2-cyanopropyl)-1,1-dimethylurea.
| Compound Name | 3-(2-cyanopropyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 78954145 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-(2-cyanopropyl)-1,1-dimethylurea |
| SMILES | CC(C#N)CNC(=O)N(C)C |
| InChI | InChI=1S/C7H13N3O/c1-6(4-8)5-9-7(11)10(2)3/h6H,5H2,1-3H3,(H,9,11) |
| InChIKey | HAFKZZAHNOOEJF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |