C6H14N2O2 — CID 83038984
3-[(2S)-2-hydroxypropyl]-1,1-dimethylurea (PubChem CID 83038984) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxypropyl]-1,1-dimethylurea.
| Compound Name | 3-[(2S)-2-hydroxypropyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83038984 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-[(2S)-2-hydroxypropyl]-1,1-dimethylurea |
| SMILES | C[C@H](O)CNC(=O)N(C)C |
| InChI | InChI=1S/C6H14N2O2/c1-5(9)4-7-6(10)8(2)3/h5,9H,4H2,1-3H3,(H,7,10)/t5-/m0/s1 |
| InChIKey | CBBPPTNMRXEOMD-YFKPBYRVSA-N |
| XLogP | -0.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |