C7H13NO2 — CID 43392750
N-(2-hydroxypropyl)cyclopropanecarboxamide (PubChem CID 43392750) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N-(2-hydroxypropyl)cyclopropanecarboxamide.
| Compound Name | N-(2-hydroxypropyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43392750 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-(2-hydroxypropyl)cyclopropanecarboxamide |
| SMILES | CC(O)CNC(=O)C1CC1 |
| InChI | InChI=1S/C7H13NO2/c1-5(9)4-8-7(10)6-2-3-6/h5-6,9H,2-4H2,1H3,(H,8,10) |
| InChIKey | MJQUDYHDZHCEIV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |