C9H19N2O2+ — CID 7172187
N-[(2S)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide (PubChem CID 7172187) has the molecular formula C9H19N2O2+ and a molecular weight of 187.26 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7172187 |
| Molecular Formula | C9H19N2O2+ |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@H](O)CNC(=O)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C9H18N2O2/c1-7(12)6-11-9(13)8-2-4-10-5-3-8/h7-8,10,12H,2-6H2,1H3,(H,11,13)/p+1/t7-/m0/s1 |
| InChIKey | SASXKISDCPJSKJ-ZETCQYMHSA-O |
| XLogP | -1.54 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |