C8H15NO3 — CID 83032356
N-[(2R)-2-hydroxypropyl]oxolane-3-carboxamide (PubChem CID 83032356) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]oxolane-3-carboxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 83032356 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]oxolane-3-carboxamide |
| SMILES | C[C@@H](O)CNC(=O)C1CCOC1 |
| InChI | InChI=1S/C8H15NO3/c1-6(10)4-9-8(11)7-2-3-12-5-7/h6-7,10H,2-5H2,1H3,(H,9,11)/t6-,7?/m1/s1 |
| InChIKey | AZJJXPPAMSRUCN-ULUSZKPHSA-N |
| XLogP | -0.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |