C9H19N2O+ — CID 7303409
N-propan-2-ylpiperidin-1-ium-4-carboxamide (PubChem CID 7303409) has the molecular formula C9H19N2O+ and a molecular weight of 171.26 g/mol. Its IUPAC name is N-propan-2-ylpiperidin-1-ium-4-carboxamide.
| Compound Name | N-propan-2-ylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7303409 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | N-propan-2-ylpiperidin-1-ium-4-carboxamide |
| SMILES | CC(C)NC(=O)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C9H18N2O/c1-7(2)11-9(12)8-3-5-10-6-4-8/h7-8,10H,3-6H2,1-2H3,(H,11,12)/p+1 |
| InChIKey | GNIDIQDKQBYDMZ-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |