C10H21N2O2+ — CID 7172191
N-(1-hydroxy-2-methylpropan-2-yl)piperidin-1-ium-4-carboxamide (PubChem CID 7172191) has the molecular formula C10H21N2O2+ and a molecular weight of 201.29 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)piperidin-1-ium-4-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7172191 |
| Molecular Formula | C10H21N2O2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)(CO)NC(=O)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,7-13)12-9(14)8-3-5-11-6-4-8/h8,11,13H,3-7H2,1-2H3,(H,12,14)/p+1 |
| InChIKey | KUWUJCGSZLLBQK-UHFFFAOYSA-O |
| XLogP | -1.15 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |