C11H18BrNO — CID 114308166
N-(1-bromo-2-methylpropan-2-yl)bicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 114308166) has the molecular formula C11H18BrNO and a molecular weight of 260.17 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)bicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)bicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 114308166 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)bicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC(C)(CBr)NC(=O)C1CC2CC2C1 |
| InChI | InChI=1S/C11H18BrNO/c1-11(2,6-12)13-10(14)9-4-7-3-8(7)5-9/h7-9H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | XRZNSWPOGOMQAV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|