C12H23NO — CID 127783603
3,5-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 127783603) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3,5-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127783603 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3,5-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CC(C)CC(C(=O)NC(C)C)C1 |
| InChI | InChI=1S/C12H23NO/c1-8(2)13-12(14)11-6-9(3)5-10(4)7-11/h8-11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | UNSHIAOGZKFPDI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |