C8H15NO4S — CID 43418379
N-(2-hydroxypropyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 43418379) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 43418379 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | N-(2-hydroxypropyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CC(O)CNC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c1-6(10)4-9-8(11)7-2-3-14(12,13)5-7/h6-7,10H,2-5H2,1H3,(H,9,11) |
| InChIKey | WBEZZTBNHXXWGE-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |