C9H15NO4S — CID 64997033
1,1-dioxo-N-(3-oxobutan-2-yl)thiolane-3-carboxamide (PubChem CID 64997033) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 1,1-dioxo-N-(3-oxobutan-2-yl)thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-(3-oxobutan-2-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 64997033 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1,1-dioxo-N-(3-oxobutan-2-yl)thiolane-3-carboxamide |
| SMILES | CC(=O)C(C)NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO4S/c1-6(7(2)11)10-9(12)8-3-4-15(13,14)5-8/h6,8H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | RNEJTCRHNUDWKV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |