C13H25NO3S — CID 134035787
N-(6-methylheptan-2-yl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 134035787) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(6-methylheptan-2-yl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 134035787 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(6-methylheptan-2-yl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CC(C)CCCC(C)NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO3S/c1-10(2)5-4-6-11(3)14-13(15)12-7-8-18(16,17)9-12/h10-12H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | MAOFJDKVNFZDOG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |