C11H19NO5S — CID 43353310
2-[(1,1-dioxothiolane-3-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 43353310) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 43353310 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C11H19NO5S/c1-7(2)5-9(11(14)15)12-10(13)8-3-4-18(16,17)6-8/h7-9H,3-6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | APWDLMRQXVRTFH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |