C9H16BrNO3S — CID 83178660
N-(4-bromobutan-2-yl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 83178660) has the molecular formula C9H16BrNO3S and a molecular weight of 298.20 g/mol. Its IUPAC name is N-(4-bromobutan-2-yl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(4-bromobutan-2-yl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 83178660 |
| Molecular Formula | C9H16BrNO3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | N-(4-bromobutan-2-yl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CC(CCBr)NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16BrNO3S/c1-7(2-4-10)11-9(12)8-3-5-15(13,14)6-8/h7-8H,2-6H2,1H3,(H,11,12) |
| InChIKey | IBCGGPPGQLXFCX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|