C10H17NO4S — CID 64996718
1,1-dioxo-N-(3-oxopentan-2-yl)thiolane-3-carboxamide (PubChem CID 64996718) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 1,1-dioxo-N-(3-oxopentan-2-yl)thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-(3-oxopentan-2-yl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 64996718 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1,1-dioxo-N-(3-oxopentan-2-yl)thiolane-3-carboxamide |
| SMILES | CCC(=O)C(C)NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO4S/c1-3-9(12)7(2)11-10(13)8-4-5-16(14,15)6-8/h7-8H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | APEKYAXBZCFXSG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |