C7H14N2O3S — CID 9092671
(3R)-N',N'-dimethyl-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9092671) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is (3R)-N',N'-dimethyl-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N',N'-dimethyl-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9092671 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (3R)-N',N'-dimethyl-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | CN(C)NC(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14N2O3S/c1-9(2)8-7(10)6-3-4-13(11,12)5-6/h6H,3-5H2,1-2H3,(H,8,10)/t6-/m0/s1 |
| InChIKey | OWFZWLSJQCAKBJ-LURJTMIESA-N |
| XLogP | -0.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|