C10H17NO4S — CID 83201861
N-cyclopentyloxy-1,1-dioxothiolane-3-carboxamide (PubChem CID 83201861) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-cyclopentyloxy-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-cyclopentyloxy-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 83201861 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-cyclopentyloxy-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NOC1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO4S/c12-10(8-5-6-16(13,14)7-8)11-15-9-3-1-2-4-9/h8-9H,1-7H2,(H,11,12) |
| InChIKey | MQLCSDVLPNXNJD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|