C7H11NO3S — CID 130667300
aziridin-1-yl-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 130667300) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is aziridin-1-yl-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | aziridin-1-yl-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 130667300 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | aziridin-1-yl-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CC1 |
| InChI | InChI=1S/C7H11NO3S/c9-7(8-2-3-8)6-1-4-12(10,11)5-6/h6H,1-5H2 |
| InChIKey | BJCVCLRCGYJJJV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|