C11H16N2O3S — CID 49063506
1-(1,1-dioxothiolane-3-carbonyl)piperidine-4-carbonitrile (PubChem CID 49063506) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolane-3-carbonyl)piperidine-4-carbonitrile.
| Compound Name | 1-(1,1-dioxothiolane-3-carbonyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 49063506 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(1,1-dioxothiolane-3-carbonyl)piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(C(=O)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H16N2O3S/c12-7-9-1-4-13(5-2-9)11(14)10-3-6-17(15,16)8-10/h9-10H,1-6,8H2 |
| InChIKey | DDNHDCXBIJHZLY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |