C12H18N2O3S — CID 113422070
1-(1,1-dioxothiane-2-carbonyl)piperidine-4-carbonitrile (PubChem CID 113422070) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiane-2-carbonyl)piperidine-4-carbonitrile.
| Compound Name | 1-(1,1-dioxothiane-2-carbonyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 113422070 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(1,1-dioxothiane-2-carbonyl)piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(C(=O)C2CCCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C12H18N2O3S/c13-9-10-4-6-14(7-5-10)12(15)11-3-1-2-8-18(11,16)17/h10-11H,1-8H2 |
| InChIKey | KWUDIMJDYNQRFE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |