C14H24N2O3S — CID 104520623
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,1-dioxothian-2-yl)methanone (PubChem CID 104520623) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,1-dioxothian-2-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,1-dioxothian-2-yl)methanone |
|---|---|
| PubChem CID | 104520623 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,1-dioxothian-2-yl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)C3CCCCS3(=O)=O)C[C@@H]2C1 |
| InChI | InChI=1S/C14H24N2O3S/c15-12-5-4-10-8-16(9-11(10)7-12)14(17)13-3-1-2-6-20(13,18)19/h10-13H,1-9,15H2/t10-,11+,12?,13?/m1/s1 |
| InChIKey | QOPPDELGCDSOCC-IALDZJHCSA-N |
| XLogP | 0.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |