C11H19NO4S — CID 107224949
(1,1-dioxothian-2-yl)-[(3S)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 107224949) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-[(3S)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | (1,1-dioxothian-2-yl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107224949 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (1,1-dioxothian-2-yl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCS1(=O)=O)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C11H19NO4S/c13-9-4-3-6-12(8-9)11(14)10-5-1-2-7-17(10,15)16/h9-10,13H,1-8H2/t9-,10?/m0/s1 |
| InChIKey | XKOBVISIEHBPGB-RGURZIINSA-N |
| XLogP | -0.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |