C12H21BrN2O3S — CID 113422485
[4-(2-bromoethyl)piperazin-1-yl]-(1,1-dioxothian-2-yl)methanone (PubChem CID 113422485) has the molecular formula C12H21BrN2O3S and a molecular weight of 353.28 g/mol. Its IUPAC name is [4-(2-bromoethyl)piperazin-1-yl]-(1,1-dioxothian-2-yl)methanone.
| Compound Name | [4-(2-bromoethyl)piperazin-1-yl]-(1,1-dioxothian-2-yl)methanone |
|---|---|
| PubChem CID | 113422485 |
| Molecular Formula | C12H21BrN2O3S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [4-(2-bromoethyl)piperazin-1-yl]-(1,1-dioxothian-2-yl)methanone |
| SMILES | O=C(C1CCCCS1(=O)=O)N1CCN(CCBr)CC1 |
| InChI | InChI=1S/C12H21BrN2O3S/c13-4-5-14-6-8-15(9-7-14)12(16)11-3-1-2-10-19(11,17)18/h11H,1-10H2 |
| InChIKey | LSLMPUBKOHPHLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|