C15H23BrN2O — CID 114097199
[4-(2-bromoethyl)piperazin-1-yl]-(3-tricyclo[3.2.1.02,4]octanyl)methanone (PubChem CID 114097199) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is [4-(2-bromoethyl)piperazin-1-yl]-(3-tricyclo[3.2.1.02,4]octanyl)methanone.
| Compound Name | [4-(2-bromoethyl)piperazin-1-yl]-(3-tricyclo[3.2.1.02,4]octanyl)methanone |
|---|---|
| PubChem CID | 114097199 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [4-(2-bromoethyl)piperazin-1-yl]-(3-tricyclo[3.2.1.02,4]octanyl)methanone |
| SMILES | O=C(C1C2C3CCC(C3)C12)N1CCN(CCBr)CC1 |
| InChI | InChI=1S/C15H23BrN2O/c16-3-4-17-5-7-18(8-6-17)15(19)14-12-10-1-2-11(9-10)13(12)14/h10-14H,1-9H2 |
| InChIKey | FRZHYQSTEOEZCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|