C12H21BrN2OS — CID 80666150
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(thiolan-3-yl)methanone (PubChem CID 80666150) has the molecular formula C12H21BrN2OS and a molecular weight of 321.28 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(thiolan-3-yl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 80666150 |
| Molecular Formula | C12H21BrN2OS |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(thiolan-3-yl)methanone |
| SMILES | O=C(C1CCSC1)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C12H21BrN2OS/c13-3-6-14-4-1-5-15(8-7-14)12(16)11-2-9-17-10-11/h11H,1-10H2 |
| InChIKey | MOVAJRCDWKWZKP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|