C8H11F2NOS — CID 130744138
(3,3-difluoroazetidin-1-yl)-(thiolan-3-yl)methanone (PubChem CID 130744138) has the molecular formula C8H11F2NOS and a molecular weight of 207.24 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-(thiolan-3-yl)methanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 130744138 |
| Molecular Formula | C8H11F2NOS |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-(thiolan-3-yl)methanone |
| SMILES | O=C(C1CCSC1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H11F2NOS/c9-8(10)4-11(5-8)7(12)6-1-2-13-3-6/h6H,1-5H2 |
| InChIKey | VNCVUJNISBZOGT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |