C11H16F2OS — CID 131204231
2-(2,2-difluorocyclopentyl)-1-(thiolan-3-yl)ethanone (PubChem CID 131204231) has the molecular formula C11H16F2OS and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-(2,2-difluorocyclopentyl)-1-(thiolan-3-yl)ethanone.
| Compound Name | 2-(2,2-difluorocyclopentyl)-1-(thiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 131204231 |
| Molecular Formula | C11H16F2OS |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(2,2-difluorocyclopentyl)-1-(thiolan-3-yl)ethanone |
| SMILES | O=C(CC1CCCC1(F)F)C1CCSC1 |
| InChI | InChI=1S/C11H16F2OS/c12-11(13)4-1-2-9(11)6-10(14)8-3-5-15-7-8/h8-9H,1-7H2 |
| InChIKey | IRNRURJVDFLQOZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |