C7H11F2NO — CID 130921420
N-[(2,2-difluorocyclopentyl)methyl]formamide (PubChem CID 130921420) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is N-[(2,2-difluorocyclopentyl)methyl]formamide.
| Compound Name | N-[(2,2-difluorocyclopentyl)methyl]formamide |
|---|---|
| PubChem CID | 130921420 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | N-[(2,2-difluorocyclopentyl)methyl]formamide |
| SMILES | O=CNCC1CCCC1(F)F |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)3-1-2-6(7)4-10-5-11/h5-6H,1-4H2,(H,10,11) |
| InChIKey | RRBFJMUKCMHFOR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|