C9H12F2N2S — CID 131091806
N-[(2,2-difluorocyclopentyl)methyl]-1,3-thiazol-2-amine (PubChem CID 131091806) has the molecular formula C9H12F2N2S and a molecular weight of 218.27 g/mol. Its IUPAC name is N-[(2,2-difluorocyclopentyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(2,2-difluorocyclopentyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131091806 |
| Molecular Formula | C9H12F2N2S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-[(2,2-difluorocyclopentyl)methyl]-1,3-thiazol-2-amine |
| SMILES | FC1(F)CCCC1CNc1nccs1 |
| InChI | InChI=1S/C9H12F2N2S/c10-9(11)3-1-2-7(9)6-13-8-12-4-5-14-8/h4-5,7H,1-3,6H2,(H,12,13) |
| InChIKey | RIEWAOMHGJUNQW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |