C9H13ClN2S — CID 106123958
N-[(3-chlorocyclopentyl)methyl]-1,3-thiazol-2-amine (PubChem CID 106123958) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106123958 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]-1,3-thiazol-2-amine |
| SMILES | ClC1CCC(CNc2nccs2)C1 |
| InChI | InChI=1S/C9H13ClN2S/c10-8-2-1-7(5-8)6-12-9-11-3-4-13-9/h3-4,7-8H,1-2,5-6H2,(H,11,12) |
| InChIKey | FFGOBMGHEKULKZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|