C10H14N2O2S — CID 130978931
2-[3-(1,3-thiazol-2-ylamino)cyclopentyl]acetic acid (PubChem CID 130978931) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-[3-(1,3-thiazol-2-ylamino)cyclopentyl]acetic acid.
| Compound Name | 2-[3-(1,3-thiazol-2-ylamino)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 130978931 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[3-(1,3-thiazol-2-ylamino)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1CCC(Nc2nccs2)C1 |
| InChI | InChI=1S/C10H14N2O2S/c13-9(14)6-7-1-2-8(5-7)12-10-11-3-4-15-10/h3-4,7-8H,1-2,5-6H2,(H,11,12)(H,13,14) |
| InChIKey | PETCHIRHJAFSSA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |