About 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol
3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol (PubChem CID 66006565) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol |
| PubChem CID | 66006565 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol |
| SMILES | OC1CC(CNc2nccs2)C1 |
| InChI | InChI=1S/C8H12N2OS/c11-7-3-6(4-7)5-10-8-9-1-2-12-8/h1-2,6-7,11H,3-5H2,(H,9,10) |
| InChIKey | ONOBUAYOYCOFFF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol?
The IUPAC name of 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol (CID 66006565) is 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol.
What is the SMILES notation for 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol?
The canonical SMILES for 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol is OC1CC(CNc2nccs2)C1.
What is the InChIKey of 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol?
The InChIKey is ONOBUAYOYCOFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c11-7-3-6(4-7)5-10-8-9-1-2-12-8/h1-2,6-7,11H,3-5H2,(H,9,10).
What are the key properties of 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol?
3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol has a molecular weight of 184.26 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-thiazol-2-ylamino)methyl]cyclobutan-1-ol is sourced from PubChem (CID 66006565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).