C12H20N4S — CID 59144373
N-[(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 59144373) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is N-[(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 59144373 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-[(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CN1CCN2C(CNc3nccs3)CCC2C1 |
| InChI | InChI=1S/C12H20N4S/c1-15-5-6-16-10(2-3-11(16)9-15)8-14-12-13-4-7-17-12/h4,7,10-11H,2-3,5-6,8-9H2,1H3,(H,13,14) |
| InChIKey | IZVZMSCOMCLRGA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |