C10H18N4S — CID 60701896
N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 60701896) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60701896 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CN1CCN(CCNc2nccs2)CC1 |
| InChI | InChI=1S/C10H18N4S/c1-13-5-7-14(8-6-13)4-2-11-10-12-3-9-15-10/h3,9H,2,4-8H2,1H3,(H,11,12) |
| InChIKey | OSVRANZVSRWVRV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |