C9H15N3S — CID 60659943
N-(2-pyrrolidin-1-ylethyl)-1,3-thiazol-2-amine (PubChem CID 60659943) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60659943 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-1,3-thiazol-2-amine |
| SMILES | c1csc(NCCN2CCCC2)n1 |
| InChI | InChI=1S/C9H15N3S/c1-2-6-12(5-1)7-3-10-9-11-4-8-13-9/h4,8H,1-3,5-7H2,(H,10,11) |
| InChIKey | WJICAKLGTZNBRT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |