C11H16N2S — CID 60658905
N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 60658905) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60658905 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | C1=C(CCNc2nccs2)CCCC1 |
| InChI | InChI=1S/C11H16N2S/c1-2-4-10(5-3-1)6-7-12-11-13-8-9-14-11/h4,8-9H,1-3,5-7H2,(H,12,13) |
| InChIKey | VIANKAVADPKPBS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|