C12H19N5 — CID 19137103
4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5,6-triamine (PubChem CID 19137103) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19137103 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]pyrimidine-4,5,6-triamine |
| SMILES | Nc1ncnc(NCCC2=CCCCC2)c1N |
| InChI | InChI=1S/C12H19N5/c13-10-11(14)16-8-17-12(10)15-7-6-9-4-2-1-3-5-9/h4,8H,1-3,5-7,13H2,(H3,14,15,16,17) |
| InChIKey | XKECLHPPTZRYCX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|