C16H20N4 — CID 107846044
4-N-[2-(cyclohexen-1-yl)ethyl]quinazoline-4,7-diamine (PubChem CID 107846044) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]quinazoline-4,7-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 107846044 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]quinazoline-4,7-diamine |
| SMILES | Nc1ccc2c(NCCC3=CCCCC3)ncnc2c1 |
| InChI | InChI=1S/C16H20N4/c17-13-6-7-14-15(10-13)19-11-20-16(14)18-9-8-12-4-2-1-3-5-12/h4,6-7,10-11H,1-3,5,8-9,17H2,(H,18,19,20) |
| InChIKey | YUSQVLBENPBFPG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|