C11H15ClN4 — CID 106812320
5-chloro-4-N-[2-(cyclopenten-1-yl)ethyl]pyrimidine-4,6-diamine (PubChem CID 106812320) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is 5-chloro-4-N-[2-(cyclopenten-1-yl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-[2-(cyclopenten-1-yl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106812320 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-chloro-4-N-[2-(cyclopenten-1-yl)ethyl]pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCCC2=CCCC2)c1Cl |
| InChI | InChI=1S/C11H15ClN4/c12-9-10(13)15-7-16-11(9)14-6-5-8-3-1-2-4-8/h3,7H,1-2,4-6H2,(H3,13,14,15,16) |
| InChIKey | VJZWEFPNXJHPBB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|