C10H15ClN4 — CID 106812243
5-chloro-4-N-(2-cyclobutylethyl)pyrimidine-4,6-diamine (PubChem CID 106812243) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 5-chloro-4-N-(2-cyclobutylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(2-cyclobutylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106812243 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-chloro-4-N-(2-cyclobutylethyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCCC2CCC2)c1Cl |
| InChI | InChI=1S/C10H15ClN4/c11-8-9(12)14-6-15-10(8)13-5-4-7-2-1-3-7/h6-7H,1-5H2,(H3,12,13,14,15) |
| InChIKey | NZPBLQKTQCNJFG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |