C12H19BrN4 — CID 106014958
5-bromo-4-N-(3-cyclopentylpropyl)pyrimidine-4,6-diamine (PubChem CID 106014958) has the molecular formula C12H19BrN4 and a molecular weight of 299.22 g/mol. Its IUPAC name is 5-bromo-4-N-(3-cyclopentylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 5-bromo-4-N-(3-cyclopentylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106014958 |
| Molecular Formula | C12H19BrN4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-bromo-4-N-(3-cyclopentylpropyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCCCC2CCCC2)c1Br |
| InChI | InChI=1S/C12H19BrN4/c13-10-11(14)16-8-17-12(10)15-7-3-6-9-4-1-2-5-9/h8-9H,1-7H2,(H3,14,15,16,17) |
| InChIKey | XTIJCRLLJOACNO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|