C11H17BrN4O — CID 114179877
[2-[(6-amino-5-bromopyrimidin-4-yl)amino]cyclohexyl]methanol (PubChem CID 114179877) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is [2-[(6-amino-5-bromopyrimidin-4-yl)amino]cyclohexyl]methanol.
| Compound Name | [2-[(6-amino-5-bromopyrimidin-4-yl)amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 114179877 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [2-[(6-amino-5-bromopyrimidin-4-yl)amino]cyclohexyl]methanol |
| SMILES | Nc1ncnc(NC2CCCCC2CO)c1Br |
| InChI | InChI=1S/C11H17BrN4O/c12-9-10(13)14-6-15-11(9)16-8-4-2-1-3-7(8)5-17/h6-8,17H,1-5H2,(H3,13,14,15,16) |
| InChIKey | KBUYEOMCFAGAJM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |