C10H14IN3O — CID 106361969
[2-[(5-iodopyrimidin-4-yl)amino]cyclopentyl]methanol (PubChem CID 106361969) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is [2-[(5-iodopyrimidin-4-yl)amino]cyclopentyl]methanol.
| Compound Name | [2-[(5-iodopyrimidin-4-yl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106361969 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | [2-[(5-iodopyrimidin-4-yl)amino]cyclopentyl]methanol |
| SMILES | OCC1CCCC1Nc1ncncc1I |
| InChI | InChI=1S/C10H14IN3O/c11-8-4-12-6-13-10(8)14-9-3-1-2-7(9)5-15/h4,6-7,9,15H,1-3,5H2,(H,12,13,14) |
| InChIKey | ZRJKFYOTXMDEKZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|