C12H18IN3 — CID 66343239
N-(2-ethylcyclohexyl)-5-iodopyrimidin-4-amine (PubChem CID 66343239) has the molecular formula C12H18IN3 and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(2-ethylcyclohexyl)-5-iodopyrimidin-4-amine.
| Compound Name | N-(2-ethylcyclohexyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66343239 |
| Molecular Formula | C12H18IN3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(2-ethylcyclohexyl)-5-iodopyrimidin-4-amine |
| SMILES | CCC1CCCCC1Nc1ncncc1I |
| InChI | InChI=1S/C12H18IN3/c1-2-9-5-3-4-6-11(9)16-12-10(13)7-14-8-15-12/h7-9,11H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | BVJCNSRXFFFSPJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|