C10H15IN4 — CID 66341197
4-N-(5-iodopyrimidin-4-yl)cyclohexane-1,4-diamine (PubChem CID 66341197) has the molecular formula C10H15IN4 and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-N-(5-iodopyrimidin-4-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(5-iodopyrimidin-4-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 66341197 |
| Molecular Formula | C10H15IN4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-N-(5-iodopyrimidin-4-yl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2ncncc2I)CC1 |
| InChI | InChI=1S/C10H15IN4/c11-9-5-13-6-14-10(9)15-8-3-1-7(12)2-4-8/h5-8H,1-4,12H2,(H,13,14,15) |
| InChIKey | BHZQZYGDIVNYPM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|