C13H20FN3O — CID 113344395
[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]cyclohexyl]methanol (PubChem CID 113344395) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is [2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]cyclohexyl]methanol.
| Compound Name | [2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 113344395 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | [2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]cyclohexyl]methanol |
| SMILES | CCc1ncnc(NC2CCCCC2CO)c1F |
| InChI | InChI=1S/C13H20FN3O/c1-2-10-12(14)13(16-8-15-10)17-11-6-4-3-5-9(11)7-18/h8-9,11,18H,2-7H2,1H3,(H,15,16,17) |
| InChIKey | JZYBDKPCCSJYHD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |