C12H16FN3 — CID 133419833
N-cyclohex-2-en-1-yl-6-ethyl-5-fluoropyrimidin-4-amine (PubChem CID 133419833) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-6-ethyl-5-fluoropyrimidin-4-amine.
| Compound Name | N-cyclohex-2-en-1-yl-6-ethyl-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 133419833 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-cyclohex-2-en-1-yl-6-ethyl-5-fluoropyrimidin-4-amine |
| SMILES | CCc1ncnc(NC2C=CCCC2)c1F |
| InChI | InChI=1S/C12H16FN3/c1-2-10-11(13)12(15-8-14-10)16-9-6-4-3-5-7-9/h4,6,8-9H,2-3,5,7H2,1H3,(H,14,15,16) |
| InChIKey | TUKFTFUPDTZETF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|