C14H21FN4 — CID 103879872
N-(6-ethyl-5-fluoropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 103879872) has the molecular formula C14H21FN4 and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(6-ethyl-5-fluoropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 103879872 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CCc1ncnc(NC2CCN3CCCCC23)c1F |
| InChI | InChI=1S/C14H21FN4/c1-2-10-13(15)14(17-9-16-10)18-11-6-8-19-7-4-3-5-12(11)19/h9,11-12H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | SLGZFILGKZCCTI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |