C12H19FN6 — CID 80904257
N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 80904257) has the molecular formula C12H19FN6 and a molecular weight of 266.32 g/mol. Its IUPAC name is N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 80904257 |
| Molecular Formula | C12H19FN6 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | NNc1ncc(F)c(NC2CCN3CCCCC23)n1 |
| InChI | InChI=1S/C12H19FN6/c13-8-7-15-12(18-14)17-11(8)16-9-4-6-19-5-2-1-3-10(9)19/h7,9-10H,1-6,14H2,(H2,15,16,17,18) |
| InChIKey | KSQWULHZPNABDC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|