C11H18FN5 — CID 80929537
N-(2,2-dimethylcyclopentyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80929537) has the molecular formula C11H18FN5 and a molecular weight of 239.30 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80929537 |
| Molecular Formula | C11H18FN5 |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | CC1(C)CCCC1Nc1nc(NN)ncc1F |
| InChI | InChI=1S/C11H18FN5/c1-11(2)5-3-4-8(11)15-9-7(12)6-14-10(16-9)17-13/h6,8H,3-5,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | LQBLYZMRAXGTKO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|